C23H21NO4S — CID 5040901
N-(2-ethyl-2-methyl-1,3-benzodioxol-5-yl)-9H-fluorene-2-sulfonamide (PubChem CID 5040901) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is N-(2-ethyl-2-methyl-1,3-benzodioxol-5-yl)-9H-fluorene-2-sulfonamide.
| Compound Name | N-(2-ethyl-2-methyl-1,3-benzodioxol-5-yl)-9H-fluorene-2-sulfonamide |
|---|---|
| PubChem CID | 5040901 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-(2-ethyl-2-methyl-1,3-benzodioxol-5-yl)-9H-fluorene-2-sulfonamide |
| SMILES | CCC1(C)Oc2ccc(NS(=O)(=O)c3ccc4c(c3)Cc3ccccc3-4)cc2O1 |
| InChI | InChI=1S/C23H21NO4S/c1-3-23(2)27-21-11-8-17(14-22(21)28-23)24-29(25,26)18-9-10-20-16(13-18)12-15-6-4-5-7-19(15)20/h4-11,13-14,24H,3,12H2,1-2H3 |
| InChIKey | QQYKYXGATABSAJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |