C17H21ClN4O — CID 5041390
N-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-chloropyridine-3-carboxamide (PubChem CID 5041390) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is N-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-chloropyridine-3-carboxamide.
| Compound Name | N-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 5041390 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[(1-tert-butyl-2,5-dimethylpyrrol-3-yl)methylideneamino]-2-chloropyridine-3-carboxamide |
| SMILES | Cc1cc(C=NNC(=O)c2cccnc2Cl)c(C)n1C(C)(C)C |
| InChI | InChI=1S/C17H21ClN4O/c1-11-9-13(12(2)22(11)17(3,4)5)10-20-21-16(23)14-7-6-8-19-15(14)18/h6-10H,1-5H3,(H,21,23) |
| InChIKey | SNLFHGFQSVBUIP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|