C28H31N3O3S3 — CID 504150
ethyl 2-[2-[[2-(4-benzylpiperidine-1-carbothioyl)sulfanyl-2-phenylacetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 504150) has the molecular formula C28H31N3O3S3 and a molecular weight of 553.78 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(4-benzylpiperidine-1-carbothioyl)sulfanyl-2-phenylacetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-(4-benzylpiperidine-1-carbothioyl)sulfanyl-2-phenylacetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 504150 |
| Molecular Formula | C28H31N3O3S3 |
| Molecular Weight | 553.78 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | ethyl 2-[2-[[2-(4-benzylpiperidine-1-carbothioyl)sulfanyl-2-phenylacetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(SC(=S)N2CCC(Cc3ccccc3)CC2)c2ccccc2)n1 |
| InChI | InChI=1S/C28H31N3O3S3/c1-2-34-24(32)18-23-19-36-27(29-23)30-26(33)25(22-11-7-4-8-12-22)37-28(35)31-15-13-21(14-16-31)17-20-9-5-3-6-10-20/h3-12,19,21,25H,2,13-18H2,1H3,(H,29,30,33) |
| InChIKey | HEFUNAAFYVVUMY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.78 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|