C21H27N6O5S+ — CID 5049528
2-[[4-(3-morpholin-4-ium-4-ylprop-1-enyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylethanone (PubChem CID 5049528) has the molecular formula C21H27N6O5S+ and a molecular weight of 475.55 g/mol. Its IUPAC name is 2-[[4-(3-morpholin-4-ium-4-ylprop-1-enyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[[4-(3-morpholin-4-ium-4-ylprop-1-enyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 5049528 |
| Molecular Formula | C21H27N6O5S+ |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[[4-(3-morpholin-4-ium-4-ylprop-1-enyl)-5-(4-nitrophenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-morpholin-4-ylethanone |
| SMILES | O=C(CSc1nnc(-c2ccc([N+](=O)[O-])cc2)n1C=CC[NH+]1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C21H26N6O5S/c28-19(25-10-14-32-15-11-25)16-33-21-23-22-20(17-2-4-18(5-3-17)27(29)30)26(21)7-1-6-24-8-12-31-13-9-24/h1-5,7H,6,8-16H2/p+1 |
| InChIKey | YCJBCYMFFODVGU-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|