C17H34OSi — CID 5052939
(6-methoxy-2,6-dimethylhepta-1,4-dien-4-yl)-methyl-dipropylsilane (PubChem CID 5052939) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is (6-methoxy-2,6-dimethylhepta-1,4-dien-4-yl)-methyl-dipropylsilane.
| Compound Name | (6-methoxy-2,6-dimethylhepta-1,4-dien-4-yl)-methyl-dipropylsilane |
|---|---|
| PubChem CID | 5052939 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | (6-methoxy-2,6-dimethylhepta-1,4-dien-4-yl)-methyl-dipropylsilane |
| SMILES | C=C(C)CC(=CC(C)(C)OC)[Si](C)(CCC)CCC |
| InChI | InChI=1S/C17H34OSi/c1-9-11-19(8,12-10-2)16(13-15(3)4)14-17(5,6)18-7/h14H,3,9-13H2,1-2,4-8H3 |
| InChIKey | NPLPDSXZHJYTAR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|