C16H27NO2 — CID 5058271
N,N-dibutyl-4-(prop-2-ynoxymethoxy)but-2-yn-1-amine (PubChem CID 5058271) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is N,N-dibutyl-4-(prop-2-ynoxymethoxy)but-2-yn-1-amine.
| Compound Name | N,N-dibutyl-4-(prop-2-ynoxymethoxy)but-2-yn-1-amine |
|---|---|
| PubChem CID | 5058271 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N,N-dibutyl-4-(prop-2-ynoxymethoxy)but-2-yn-1-amine |
| SMILES | C#CCOCOCC#CCN(CCCC)CCCC |
| InChI | InChI=1S/C16H27NO2/c1-4-7-11-17(12-8-5-2)13-9-10-15-19-16-18-14-6-3/h3H,4-5,7-8,11-16H2,1-2H3 |
| InChIKey | KLLJUTRQSGUSDV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|