C27H25FO5 — CID 5061999
2-tert-butyl-5-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-2-methyl-1,3-dioxane-4,6-dione (PubChem CID 5061999) has the molecular formula C27H25FO5 and a molecular weight of 448.49 g/mol. Its IUPAC name is 2-tert-butyl-5-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-2-methyl-1,3-dioxane-4,6-dione.
| Compound Name | 2-tert-butyl-5-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-2-methyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 5061999 |
| Molecular Formula | C27H25FO5 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-tert-butyl-5-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylidene]-2-methyl-1,3-dioxane-4,6-dione |
| SMILES | CC(C)(C)C1(C)OC(=O)C(=Cc2c(OCc3ccccc3F)ccc3ccccc23)C(=O)O1 |
| InChI | InChI=1S/C27H25FO5/c1-26(2,3)27(4)32-24(29)21(25(30)33-27)15-20-19-11-7-5-9-17(19)13-14-23(20)31-16-18-10-6-8-12-22(18)28/h5-15H,16H2,1-4H3/b21-15- |
| InChIKey | KIJVRQKHNBLNQZ-QNGOZBTKSA-N |
| XLogP | 5.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|