C23H29BrN2O — CID 5065191
4-bromo-2-[6-(4-ethylphenyl)-2-methyl-2-(2-methylpropyl)-3,4-dihydro-1H-pyrimidin-4-yl]phenol (PubChem CID 5065191) has the molecular formula C23H29BrN2O and a molecular weight of 429.40 g/mol. Its IUPAC name is 4-bromo-2-[6-(4-ethylphenyl)-2-methyl-2-(2-methylpropyl)-3,4-dihydro-1H-pyrimidin-4-yl]phenol.
| Compound Name | 4-bromo-2-[6-(4-ethylphenyl)-2-methyl-2-(2-methylpropyl)-3,4-dihydro-1H-pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 5065191 |
| Molecular Formula | C23H29BrN2O |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 4-bromo-2-[6-(4-ethylphenyl)-2-methyl-2-(2-methylpropyl)-3,4-dihydro-1H-pyrimidin-4-yl]phenol |
| SMILES | CCc1ccc(C2=CC(c3cc(Br)ccc3O)NC(C)(CC(C)C)N2)cc1 |
| InChI | InChI=1S/C23H29BrN2O/c1-5-16-6-8-17(9-7-16)20-13-21(19-12-18(24)10-11-22(19)27)26-23(4,25-20)14-15(2)3/h6-13,15,21,25-27H,5,14H2,1-4H3 |
| InChIKey | VRHGVNXKWBIDCE-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|