C24H28BrN3O3 — CID 3554647
2-[4-(1,3-benzodioxol-5-yl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-3-en-2-yl]-4-bromophenol (PubChem CID 3554647) has the molecular formula C24H28BrN3O3 and a molecular weight of 486.41 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-3-en-2-yl]-4-bromophenol.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-3-en-2-yl]-4-bromophenol |
|---|---|
| PubChem CID | 3554647 |
| Molecular Formula | C24H28BrN3O3 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-9-propan-2-yl-1,5,9-triazaspiro[5.5]undec-3-en-2-yl]-4-bromophenol |
| SMILES | CC(C)N1CCC2(CC1)NC(c1ccc3c(c1)OCO3)=CC(c1cc(Br)ccc1O)N2 |
| InChI | InChI=1S/C24H28BrN3O3/c1-15(2)28-9-7-24(8-10-28)26-19(16-3-6-22-23(11-16)31-14-30-22)13-20(27-24)18-12-17(25)4-5-21(18)29/h3-6,11-13,15,20,26-27,29H,7-10,14H2,1-2H3 |
| InChIKey | NKSWVQXHAWIKSJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|