C21H24N2O3 — CID 5064981
2-[6-(1,3-benzodioxol-5-yl)-2-methyl-2-propan-2-yl-3,4-dihydro-1H-pyrimidin-4-yl]phenol (PubChem CID 5064981) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-[6-(1,3-benzodioxol-5-yl)-2-methyl-2-propan-2-yl-3,4-dihydro-1H-pyrimidin-4-yl]phenol.
| Compound Name | 2-[6-(1,3-benzodioxol-5-yl)-2-methyl-2-propan-2-yl-3,4-dihydro-1H-pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 5064981 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-[6-(1,3-benzodioxol-5-yl)-2-methyl-2-propan-2-yl-3,4-dihydro-1H-pyrimidin-4-yl]phenol |
| SMILES | CC(C)C1(C)NC(c2ccc3c(c2)OCO3)=CC(c2ccccc2O)N1 |
| InChI | InChI=1S/C21H24N2O3/c1-13(2)21(3)22-16(14-8-9-19-20(10-14)26-12-25-19)11-17(23-21)15-6-4-5-7-18(15)24/h4-11,13,17,22-24H,12H2,1-3H3 |
| InChIKey | YSGDWOSKKNMNOF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|