C23H19BrFN2O3+ — CID 4609798
2-[6-(1,3-benzodioxol-5-yl)-2-(3-bromo-4-fluorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol (PubChem CID 4609798) has the molecular formula C23H19BrFN2O3+ and a molecular weight of 470.32 g/mol. Its IUPAC name is 2-[6-(1,3-benzodioxol-5-yl)-2-(3-bromo-4-fluorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol.
| Compound Name | 2-[6-(1,3-benzodioxol-5-yl)-2-(3-bromo-4-fluorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
|---|---|
| PubChem CID | 4609798 |
| Molecular Formula | C23H19BrFN2O3+ |
| Molecular Weight | 470.32 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | 2-[6-(1,3-benzodioxol-5-yl)-2-(3-bromo-4-fluorophenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
| SMILES | Oc1ccccc1C1C=C(c2ccc3c(c2)OCO3)NC(c2ccc(F)c(Br)c2)[NH2+]1 |
| InChI | InChI=1S/C23H18BrFN2O3/c24-16-9-14(5-7-17(16)25)23-26-18(13-6-8-21-22(10-13)30-12-29-21)11-19(27-23)15-3-1-2-4-20(15)28/h1-11,19,23,26-28H,12H2/p+1 |
| InChIKey | KVUIWDVVORHZSS-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|