C24H25N2O2+ — CID 4168411
2-[2-(2-methoxyphenyl)-6-(4-methylphenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol (PubChem CID 4168411) has the molecular formula C24H25N2O2+ and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)-6-(4-methylphenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol.
| Compound Name | 2-[2-(2-methoxyphenyl)-6-(4-methylphenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
|---|---|
| PubChem CID | 4168411 |
| Molecular Formula | C24H25N2O2+ |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)-6-(4-methylphenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
| SMILES | COc1ccccc1C1NC(c2ccc(C)cc2)=CC(c2ccccc2O)[NH2+]1 |
| InChI | InChI=1S/C24H24N2O2/c1-16-11-13-17(14-12-16)20-15-21(18-7-3-5-9-22(18)27)26-24(25-20)19-8-4-6-10-23(19)28-2/h3-15,21,24-27H,1-2H3/p+1 |
| InChIKey | XKDOHSXYJHEJDO-UHFFFAOYSA-O |
| XLogP | 3.66 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|