C24H24BrN2O2+ — CID 5202672
2-[2-(3-bromo-4-methoxyphenyl)-6-(4-methylphenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol (PubChem CID 5202672) has the molecular formula C24H24BrN2O2+ and a molecular weight of 452.37 g/mol. Its IUPAC name is 2-[2-(3-bromo-4-methoxyphenyl)-6-(4-methylphenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol.
| Compound Name | 2-[2-(3-bromo-4-methoxyphenyl)-6-(4-methylphenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
|---|---|
| PubChem CID | 5202672 |
| Molecular Formula | C24H24BrN2O2+ |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2-[2-(3-bromo-4-methoxyphenyl)-6-(4-methylphenyl)-1,2,3,4-tetrahydropyrimidin-3-ium-4-yl]phenol |
| SMILES | COc1ccc(C2NC(c3ccc(C)cc3)=CC(c3ccccc3O)[NH2+]2)cc1Br |
| InChI | InChI=1S/C24H23BrN2O2/c1-15-7-9-16(10-8-15)20-14-21(18-5-3-4-6-22(18)28)27-24(26-20)17-11-12-23(29-2)19(25)13-17/h3-14,21,24,26-28H,1-2H3/p+1 |
| InChIKey | ZESNTWRCVYAEBB-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|