C23H23ClN4 — CID 5067370
N-butyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 5067370) has the molecular formula C23H23ClN4 and a molecular weight of 390.92 g/mol. Its IUPAC name is N-butyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-butyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 5067370 |
| Molecular Formula | C23H23ClN4 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-butyl-7-(3-chloro-4-methylphenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCNc1ncnc2c1c(-c1ccccc1)cn2-c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C23H23ClN4/c1-3-4-12-25-22-21-19(17-8-6-5-7-9-17)14-28(23(21)27-15-26-22)18-11-10-16(2)20(24)13-18/h5-11,13-15H,3-4,12H2,1-2H3,(H,25,26,27) |
| InChIKey | XWMYETSSGVTNDO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|