C16H21N3O4S2 — CID 5068638
N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-4-methylbenzenesulfonamide (PubChem CID 5068638) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 5068638 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-4-methylbenzenesulfonamide |
| SMILES | COc1cc(OC)nc(CSCCNS(=O)(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C16H21N3O4S2/c1-12-4-6-13(7-5-12)25(20,21)17-8-9-24-11-14-18-15(22-2)10-16(19-14)23-3/h4-7,10,17H,8-9,11H2,1-3H3 |
| InChIKey | DIHBANSURBUMNU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|