C17H17Br2ClN2O3S — CID 50740270
2-[(4-chlorophenyl)sulfonylamino]-N-(2,4-dibromo-6-methylphenyl)butanamide (PubChem CID 50740270) has the molecular formula C17H17Br2ClN2O3S and a molecular weight of 524.66 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-(2,4-dibromo-6-methylphenyl)butanamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(2,4-dibromo-6-methylphenyl)butanamide |
|---|---|
| PubChem CID | 50740270 |
| Molecular Formula | C17H17Br2ClN2O3S |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 521.90 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(2,4-dibromo-6-methylphenyl)butanamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)Nc1c(C)cc(Br)cc1Br |
| InChI | InChI=1S/C17H17Br2ClN2O3S/c1-3-15(22-26(24,25)13-6-4-12(20)5-7-13)17(23)21-16-10(2)8-11(18)9-14(16)19/h4-9,15,22H,3H2,1-2H3,(H,21,23) |
| InChIKey | GVKYONGLJGAYJG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |