4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid

C7H9N3O3S — CID 50743413

IUPAC4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid
SMILESCCNC(=O)c1nsc(C(=O)O)c1N
InChIInChI=1S/C7H9N3O3S/c1-2-9-6(11)4-3(8)5(7(12)13)14-10-4/h2,8H2,1H3,(H,9,11)(H,12,13)
InChIKeyZLUSPDOAPZBHIV-UHFFFAOYSA-N
MW215.23 g/mol
LogP0.17
Rot. Bonds3

About 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid

4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 50743413) has the molecular formula C7H9N3O3S and a molecular weight of 215.23 g/mol. Its IUPAC name is 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid
PubChem CID50743413
Molecular FormulaC7H9N3O3S
Molecular Weight215.23 g/mol
Exact Mass215.04
IUPAC Name4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid
SMILESCCNC(=O)c1nsc(C(=O)O)c1N
InChIInChI=1S/C7H9N3O3S/c1-2-9-6(11)4-3(8)5(7(12)13)14-10-4/h2,8H2,1H3,(H,9,11)(H,12,13)
InChIKeyZLUSPDOAPZBHIV-UHFFFAOYSA-N
XLogP0.17
TPSA105.31 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.23
LogP ≤ 50.17
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The IUPAC name of 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid (CID 50743413) is 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The canonical SMILES for 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid is CCNC(=O)c1nsc(C(=O)O)c1N.
What is the InChIKey of 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The InChIKey is ZLUSPDOAPZBHIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O3S/c1-2-9-6(11)4-3(8)5(7(12)13)14-10-4/h2,8H2,1H3,(H,9,11)(H,12,13).
What are the key properties of 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid has a molecular weight of 215.23 g/mol, XLogP of 0.17, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid is sourced from PubChem (CID 50743413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).