C22H22N2O3S — CID 50759973
3-cyclopentylidene-5-(2,3-dihydroindol-1-ylsulfonyl)-1-methylindol-2-one (PubChem CID 50759973) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 3-cyclopentylidene-5-(2,3-dihydroindol-1-ylsulfonyl)-1-methylindol-2-one.
| Compound Name | 3-cyclopentylidene-5-(2,3-dihydroindol-1-ylsulfonyl)-1-methylindol-2-one |
|---|---|
| PubChem CID | 50759973 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-cyclopentylidene-5-(2,3-dihydroindol-1-ylsulfonyl)-1-methylindol-2-one |
| SMILES | CN1C(=O)C(=C2CCCC2)c2cc(S(=O)(=O)N3CCc4ccccc43)ccc21 |
| InChI | InChI=1S/C22H22N2O3S/c1-23-20-11-10-17(14-18(20)21(22(23)25)16-7-2-3-8-16)28(26,27)24-13-12-15-6-4-5-9-19(15)24/h4-6,9-11,14H,2-3,7-8,12-13H2,1H3 |
| InChIKey | WAIYPQGOQYVUQT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|