C22H25N5O3S — CID 50760120
3-cyclopentylidene-1-methyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylindol-2-one (PubChem CID 50760120) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 3-cyclopentylidene-1-methyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylindol-2-one.
| Compound Name | 3-cyclopentylidene-1-methyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylindol-2-one |
|---|---|
| PubChem CID | 50760120 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 3-cyclopentylidene-1-methyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylindol-2-one |
| SMILES | CN1C(=O)C(=C2CCCC2)c2cc(S(=O)(=O)N3CCN(c4ncccn4)CC3)ccc21 |
| InChI | InChI=1S/C22H25N5O3S/c1-25-19-8-7-17(15-18(19)20(21(25)28)16-5-2-3-6-16)31(29,30)27-13-11-26(12-14-27)22-23-9-4-10-24-22/h4,7-10,15H,2-3,5-6,11-14H2,1H3 |
| InChIKey | KZCDPEYHTCSFHO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|