C22H22F3N3O7S — CID 5076853
propan-2-yl 2-[5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonylamino]-2-hydroxyphenyl]-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 5076853) has the molecular formula C22H22F3N3O7S and a molecular weight of 529.49 g/mol. Its IUPAC name is propan-2-yl 2-[5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonylamino]-2-hydroxyphenyl]-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | propan-2-yl 2-[5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonylamino]-2-hydroxyphenyl]-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 5076853 |
| Molecular Formula | C22H22F3N3O7S |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | propan-2-yl 2-[5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)sulfonylamino]-2-hydroxyphenyl]-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CC(C)OC(=O)C(C(=O)C(F)(F)F)c1cc(NS(=O)(=O)c2ccc3c(c2)n(C)c(=O)n3C)ccc1O |
| InChI | InChI=1S/C22H22F3N3O7S/c1-11(2)35-20(31)18(19(30)22(23,24)25)14-9-12(5-8-17(14)29)26-36(33,34)13-6-7-15-16(10-13)28(4)21(32)27(15)3/h5-11,18,26,29H,1-4H3 |
| InChIKey | GCPJAOGXQAWWAA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|