C17H23F3N2O7S2 — CID 40851724
propan-2-yl (2S)-2-[2,5-bis(ethylsulfonylamino)phenyl]-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 40851724) has the molecular formula C17H23F3N2O7S2 and a molecular weight of 488.51 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[2,5-bis(ethylsulfonylamino)phenyl]-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | propan-2-yl (2S)-2-[2,5-bis(ethylsulfonylamino)phenyl]-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 40851724 |
| Molecular Formula | C17H23F3N2O7S2 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | propan-2-yl (2S)-2-[2,5-bis(ethylsulfonylamino)phenyl]-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCS(=O)(=O)Nc1ccc(NS(=O)(=O)CC)c([C@H](C(=O)OC(C)C)C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2O7S2/c1-5-30(25,26)21-11-7-8-13(22-31(27,28)6-2)12(9-11)14(15(23)17(18,19)20)16(24)29-10(3)4/h7-10,14,21-22H,5-6H2,1-4H3/t14-/m0/s1 |
| InChIKey | KIHDOHVZKHZVDC-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|