C21H22F3NO6S — CID 2270346
propan-2-yl (2S)-2-[5-[(2,5-dimethylphenyl)sulfonylamino]-2-hydroxyphenyl]-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 2270346) has the molecular formula C21H22F3NO6S and a molecular weight of 473.47 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[5-[(2,5-dimethylphenyl)sulfonylamino]-2-hydroxyphenyl]-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | propan-2-yl (2S)-2-[5-[(2,5-dimethylphenyl)sulfonylamino]-2-hydroxyphenyl]-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 2270346 |
| Molecular Formula | C21H22F3NO6S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | propan-2-yl (2S)-2-[5-[(2,5-dimethylphenyl)sulfonylamino]-2-hydroxyphenyl]-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(O)c([C@H](C(=O)OC(C)C)C(=O)C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H22F3NO6S/c1-11(2)31-20(28)18(19(27)21(22,23)24)15-10-14(7-8-16(15)26)25-32(29,30)17-9-12(3)5-6-13(17)4/h5-11,18,25-26H,1-4H3/t18-/m0/s1 |
| InChIKey | VYCZVIUCKXHVQJ-SFHVURJKSA-N |
| XLogP | 3.98 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|