C25H19ClN2OS — CID 5076971
14-[(4-chlorophenyl)methylidene]-3-thia-1,12-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),12,15,17,19-hexaen-11-one (PubChem CID 5076971) has the molecular formula C25H19ClN2OS and a molecular weight of 430.96 g/mol. Its IUPAC name is 14-[(4-chlorophenyl)methylidene]-3-thia-1,12-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),12,15,17,19-hexaen-11-one.
| Compound Name | 14-[(4-chlorophenyl)methylidene]-3-thia-1,12-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),12,15,17,19-hexaen-11-one |
|---|---|
| PubChem CID | 5076971 |
| Molecular Formula | C25H19ClN2OS |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 14-[(4-chlorophenyl)methylidene]-3-thia-1,12-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),12,15,17,19-hexaen-11-one |
| SMILES | O=c1nc2n(c3sc4c(c13)CCCC4)Cc1ccccc1C2=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClN2OS/c26-17-11-9-15(10-12-17)13-20-18-6-2-1-5-16(18)14-28-23(20)27-24(29)22-19-7-3-4-8-21(19)30-25(22)28/h1-2,5-6,9-13H,3-4,7-8,14H2 |
| InChIKey | OAHQLRVJTOYAPV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|