C24H17BrN2O2S — CID 135909633
(13E)-13-[(4-bromophenyl)-hydroxymethylidene]-3-thia-1,11-diazapentacyclo[10.8.0.02,9.04,8.014,19]icosa-2(9),4(8),11,14,16,18-hexaen-10-one (PubChem CID 135909633) has the molecular formula C24H17BrN2O2S and a molecular weight of 477.38 g/mol. Its IUPAC name is (13E)-13-[(4-bromophenyl)-hydroxymethylidene]-3-thia-1,11-diazapentacyclo[10.8.0.02,9.04,8.014,19]icosa-2(9),4(8),11,14,16,18-hexaen-10-one.
| Compound Name | (13E)-13-[(4-bromophenyl)-hydroxymethylidene]-3-thia-1,11-diazapentacyclo[10.8.0.02,9.04,8.014,19]icosa-2(9),4(8),11,14,16,18-hexaen-10-one |
|---|---|
| PubChem CID | 135909633 |
| Molecular Formula | C24H17BrN2O2S |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | (13E)-13-[(4-bromophenyl)-hydroxymethylidene]-3-thia-1,11-diazapentacyclo[10.8.0.02,9.04,8.014,19]icosa-2(9),4(8),11,14,16,18-hexaen-10-one |
| SMILES | O=c1nc2n(c3sc4c(c13)CCC4)Cc1ccccc1/C2=C(\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H17BrN2O2S/c25-15-10-8-13(9-11-15)21(28)19-16-5-2-1-4-14(16)12-27-22(19)26-23(29)20-17-6-3-7-18(17)30-24(20)27/h1-2,4-5,8-11,28H,3,6-7,12H2/b21-19+ |
| InChIKey | OLTYVIGZGSRSNJ-XUTLUUPISA-N |
| XLogP | 5.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|