C23H15FN2O3S2 — CID 5452354
(4E)-4-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-5,16-dithia-2,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),6,10(15)-triene-3,8-dione (PubChem CID 5452354) has the molecular formula C23H15FN2O3S2 and a molecular weight of 450.52 g/mol. Its IUPAC name is (4E)-4-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-5,16-dithia-2,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),6,10(15)-triene-3,8-dione.
| Compound Name | (4E)-4-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-5,16-dithia-2,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),6,10(15)-triene-3,8-dione |
|---|---|
| PubChem CID | 5452354 |
| Molecular Formula | C23H15FN2O3S2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | (4E)-4-[[5-(2-fluorophenyl)furan-2-yl]methylidene]-5,16-dithia-2,7-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),6,10(15)-triene-3,8-dione |
| SMILES | O=c1nc2s/c(=C/c3ccc(-c4ccccc4F)o3)c(=O)n2c2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C23H15FN2O3S2/c24-15-7-3-1-5-13(15)16-10-9-12(29-16)11-18-21(28)26-22-19(20(27)25-23(26)31-18)14-6-2-4-8-17(14)30-22/h1,3,5,7,9-11H,2,4,6,8H2/b18-11+ |
| InChIKey | WVHSGWRTZJGADK-WOJGMQOQSA-N |
| XLogP | 4.16 |
| TPSA | 64.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |