C14H21N3O3S2 — CID 50772642
N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)methanesulfonamide (PubChem CID 50772642) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)methanesulfonamide.
| Compound Name | N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 50772642 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)methanesulfonamide |
| SMILES | CCCCSc1cc2c(cc1NS(C)(=O)=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H21N3O3S2/c1-5-6-7-21-13-9-12-11(16(2)14(18)17(12)3)8-10(13)15-22(4,19)20/h8-9,15H,5-7H2,1-4H3 |
| InChIKey | TUHNMAAANKUQOL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|