C23H29N3O5S — CID 35397680
N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-3,4,5-trimethoxybenzamide (PubChem CID 35397680) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 35397680 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-(6-butylsulfanyl-1,3-dimethyl-2-oxobenzimidazol-5-yl)-3,4,5-trimethoxybenzamide |
| SMILES | CCCCSc1cc2c(cc1NC(=O)c1cc(OC)c(OC)c(OC)c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C23H29N3O5S/c1-7-8-9-32-20-13-17-16(25(2)23(28)26(17)3)12-15(20)24-22(27)14-10-18(29-4)21(31-6)19(11-14)30-5/h10-13H,7-9H2,1-6H3,(H,24,27) |
| InChIKey | GYWJNPBGCQROIL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|