C18H18N8O4S2 — CID 50779244
1-(2-methoxyphenyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea (PubChem CID 50779244) has the molecular formula C18H18N8O4S2 and a molecular weight of 474.53 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(2-methoxyphenyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 50779244 |
| Molecular Formula | C18H18N8O4S2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea |
| SMILES | COc1ccccc1NC(=O)Nc1nnc(Sc2nc3c(c(=O)n(C)c(=O)n3C)n2C)s1 |
| InChI | InChI=1S/C18H18N8O4S2/c1-24-11-12(25(2)18(29)26(3)13(11)27)20-16(24)32-17-23-22-15(31-17)21-14(28)19-9-7-5-6-8-10(9)30-4/h5-8H,1-4H3,(H2,19,21,22,28) |
| InChIKey | KOWIFIDHJOWYPF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|