C18H17ClN8O3S2 — CID 50779182
1-(3-chloro-2-methylphenyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea (PubChem CID 50779182) has the molecular formula C18H17ClN8O3S2 and a molecular weight of 492.97 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea |
|---|---|
| PubChem CID | 50779182 |
| Molecular Formula | C18H17ClN8O3S2 |
| Molecular Weight | 492.97 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-[5-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)sulfanyl-1,3,4-thiadiazol-2-yl]urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)Nc1nnc(Sc2nc3c(c(=O)n(C)c(=O)n3C)n2C)s1 |
| InChI | InChI=1S/C18H17ClN8O3S2/c1-8-9(19)6-5-7-10(8)20-14(29)22-15-23-24-17(31-15)32-16-21-12-11(25(16)2)13(28)27(4)18(30)26(12)3/h5-7H,1-4H3,(H2,20,22,23,29) |
| InChIKey | APOUSZQGPHSBSB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.97 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|