C24H23N5O3S2 — CID 50784960
N-(4-butylphenyl)-2-[[8-(furan-2-ylmethyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetamide (PubChem CID 50784960) has the molecular formula C24H23N5O3S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-[[8-(furan-2-ylmethyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetamide.
| Compound Name | N-(4-butylphenyl)-2-[[8-(furan-2-ylmethyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 50784960 |
| Molecular Formula | C24H23N5O3S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-(4-butylphenyl)-2-[[8-(furan-2-ylmethyl)-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl]sulfanyl]acetamide |
| SMILES | CCCCc1ccc(NC(=O)CSc2nnc3n(Cc4ccco4)c(=O)c4sccc4n23)cc1 |
| InChI | InChI=1S/C24H23N5O3S2/c1-2-3-5-16-7-9-17(10-8-16)25-20(30)15-34-24-27-26-23-28(14-18-6-4-12-32-18)22(31)21-19(29(23)24)11-13-33-21/h4,6-13H,2-3,5,14-15H2,1H3,(H,25,30) |
| InChIKey | FLICCIPLBLVAQX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 94.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |