C25H25N3O5S — CID 50792964
N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-4-propylbenzenesulfonamide (PubChem CID 50792964) has the molecular formula C25H25N3O5S and a molecular weight of 479.56 g/mol. Its IUPAC name is N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-4-propylbenzenesulfonamide.
| Compound Name | N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 50792964 |
| Molecular Formula | C25H25N3O5S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-(1,4-dimethyl-2,3-dioxo-7-phenoxyquinoxalin-6-yl)-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)Nc2cc3c(cc2Oc2ccccc2)n(C)c(=O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C25H25N3O5S/c1-4-8-17-11-13-19(14-12-17)34(31,32)26-20-15-21-22(28(3)25(30)24(29)27(21)2)16-23(20)33-18-9-6-5-7-10-18/h5-7,9-16,26H,4,8H2,1-3H3 |
| InChIKey | KFJOZVOUUWXCMU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|