C19H16ClN5O — CID 50800850
N-(5-chloro-2-methylphenyl)-11-(furan-2-yl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 50800850) has the molecular formula C19H16ClN5O and a molecular weight of 365.82 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-11-(furan-2-yl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-(5-chloro-2-methylphenyl)-11-(furan-2-yl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 50800850 |
| Molecular Formula | C19H16ClN5O |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-11-(furan-2-yl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | Cc1ccc(Cl)cc1Nc1c2c(nc3nc(-c4ccco4)nn13)CCC2 |
| InChI | InChI=1S/C19H16ClN5O/c1-11-7-8-12(20)10-15(11)21-18-13-4-2-5-14(13)22-19-23-17(24-25(18)19)16-6-3-9-26-16/h3,6-10,21H,2,4-5H2,1H3 |
| InChIKey | YJIIXWJPENSJFT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |