C18H14ClN5O — CID 50800717
N-(3-chlorophenyl)-11-(furan-2-yl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 50800717) has the molecular formula C18H14ClN5O and a molecular weight of 351.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-11-(furan-2-yl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | N-(3-chlorophenyl)-11-(furan-2-yl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 50800717 |
| Molecular Formula | C18H14ClN5O |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(3-chlorophenyl)-11-(furan-2-yl)-1,8,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | Clc1cccc(Nc2c3c(nc4nc(-c5ccco5)nn24)CCC3)c1 |
| InChI | InChI=1S/C18H14ClN5O/c19-11-4-1-5-12(10-11)20-17-13-6-2-7-14(13)21-18-22-16(23-24(17)18)15-8-3-9-25-15/h1,3-5,8-10,20H,2,6-7H2 |
| InChIKey | SITZVOLUUXANOV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.80 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |