C19H23N3O3S2 — CID 50801937
5-(diethylsulfamoyl)-1-methyl-N-(thiophen-2-ylmethyl)indole-2-carboxamide (PubChem CID 50801937) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-1-methyl-N-(thiophen-2-ylmethyl)indole-2-carboxamide.
| Compound Name | 5-(diethylsulfamoyl)-1-methyl-N-(thiophen-2-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 50801937 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 5-(diethylsulfamoyl)-1-methyl-N-(thiophen-2-ylmethyl)indole-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)cc(C(=O)NCc1cccs1)n2C |
| InChI | InChI=1S/C19H23N3O3S2/c1-4-22(5-2)27(24,25)16-8-9-17-14(11-16)12-18(21(17)3)19(23)20-13-15-7-6-10-26-15/h6-12H,4-5,13H2,1-3H3,(H,20,23) |
| InChIKey | YREMTUQJXLQPKE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |