C21H22N6O3 — CID 50802539
1-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-4-prop-2-enylquinoxaline-2,3-dione (PubChem CID 50802539) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is 1-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-4-prop-2-enylquinoxaline-2,3-dione.
| Compound Name | 1-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-4-prop-2-enylquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 50802539 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 1-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-4-prop-2-enylquinoxaline-2,3-dione |
| SMILES | C=CCn1c(=O)c(=O)n(CC(=O)N2CCN(c3ncccn3)CC2)c2ccccc21 |
| InChI | InChI=1S/C21H22N6O3/c1-2-10-26-16-6-3-4-7-17(16)27(20(30)19(26)29)15-18(28)24-11-13-25(14-12-24)21-22-8-5-9-23-21/h2-9H,1,10-15H2 |
| InChIKey | QWZFTDOAWGGQFL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 93.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|