C26H24N2O6S — CID 50836547
methyl 2-[6-[(3-methoxyphenyl)sulfonylamino]-2-(4-methylphenyl)quinolin-4-yl]oxyacetate (PubChem CID 50836547) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is methyl 2-[6-[(3-methoxyphenyl)sulfonylamino]-2-(4-methylphenyl)quinolin-4-yl]oxyacetate.
| Compound Name | methyl 2-[6-[(3-methoxyphenyl)sulfonylamino]-2-(4-methylphenyl)quinolin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 50836547 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | methyl 2-[6-[(3-methoxyphenyl)sulfonylamino]-2-(4-methylphenyl)quinolin-4-yl]oxyacetate |
| SMILES | COC(=O)COc1cc(-c2ccc(C)cc2)nc2ccc(NS(=O)(=O)c3cccc(OC)c3)cc12 |
| InChI | InChI=1S/C26H24N2O6S/c1-17-7-9-18(10-8-17)24-15-25(34-16-26(29)33-3)22-13-19(11-12-23(22)27-24)28-35(30,31)21-6-4-5-20(14-21)32-2/h4-15,28H,16H2,1-3H3 |
| InChIKey | KOOPYOXFHHKBPZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |