C23H27N5O2 — CID 50842540
N-butan-2-yl-1-[5-[(4-cyanobenzoyl)amino]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 50842540) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-butan-2-yl-1-[5-[(4-cyanobenzoyl)amino]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | N-butan-2-yl-1-[5-[(4-cyanobenzoyl)amino]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50842540 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-butan-2-yl-1-[5-[(4-cyanobenzoyl)amino]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | CCC(C)NC(=O)C1CCN(c2ccc(NC(=O)c3ccc(C#N)cc3)cn2)CC1 |
| InChI | InChI=1S/C23H27N5O2/c1-3-16(2)26-22(29)19-10-12-28(13-11-19)21-9-8-20(15-25-21)27-23(30)18-6-4-17(14-24)5-7-18/h4-9,15-16,19H,3,10-13H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | PRLQTPJZIVMMPM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |