C9H6Cl2N2OS2 — CID 50852480
1,3-bis(4-chlorothiophen-3-yl)urea (PubChem CID 50852480) has the molecular formula C9H6Cl2N2OS2 and a molecular weight of 293.20 g/mol. Its IUPAC name is 1,3-bis(4-chlorothiophen-3-yl)urea.
| Compound Name | 1,3-bis(4-chlorothiophen-3-yl)urea |
|---|---|
| PubChem CID | 50852480 |
| Molecular Formula | C9H6Cl2N2OS2 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 291.93 |
| IUPAC Name | 1,3-bis(4-chlorothiophen-3-yl)urea |
| SMILES | O=C(Nc1cscc1Cl)Nc1cscc1Cl |
| InChI | InChI=1S/C9H6Cl2N2OS2/c10-5-1-15-3-7(5)12-9(14)13-8-4-16-2-6(8)11/h1-4H,(H2,12,13,14) |
| InChIKey | BPZLMFQKRXTCKO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |