C15H14N2O3 — CID 50883796
(4Z)-4-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-methyl-1H-pyrazol-5-one (PubChem CID 50883796) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is (4Z)-4-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-methyl-1H-pyrazol-5-one.
| Compound Name | (4Z)-4-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-methyl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 50883796 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (4Z)-4-[(3-methoxy-4-prop-2-ynoxyphenyl)methylidene]-3-methyl-1H-pyrazol-5-one |
| SMILES | C#CCOc1ccc(/C=C2\C(=O)NN=C2C)cc1OC |
| InChI | InChI=1S/C15H14N2O3/c1-4-7-20-13-6-5-11(9-14(13)19-3)8-12-10(2)16-17-15(12)18/h1,5-6,8-9H,7H2,2-3H3,(H,17,18)/b12-8- |
| InChIKey | LECMJDTUFOHESC-WQLSENKSSA-N |
| XLogP | 1.60 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|