C16H20N2O3 — CID 6197233
(4Z)-4-[(4-butoxy-3-methoxyphenyl)methylidene]-3-methyl-1H-pyrazol-5-one (PubChem CID 6197233) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (4Z)-4-[(4-butoxy-3-methoxyphenyl)methylidene]-3-methyl-1H-pyrazol-5-one.
| Compound Name | (4Z)-4-[(4-butoxy-3-methoxyphenyl)methylidene]-3-methyl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 6197233 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (4Z)-4-[(4-butoxy-3-methoxyphenyl)methylidene]-3-methyl-1H-pyrazol-5-one |
| SMILES | CCCCOc1ccc(/C=C2\C(=O)NN=C2C)cc1OC |
| InChI | InChI=1S/C16H20N2O3/c1-4-5-8-21-14-7-6-12(10-15(14)20-3)9-13-11(2)17-18-16(13)19/h6-7,9-10H,4-5,8H2,1-3H3,(H,18,19)/b13-9- |
| InChIKey | YWMABFHJBZHUDG-LCYFTJDESA-N |
| XLogP | 2.76 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|