C25H24N4O6 — CID 50884861
(5E)-1-(2-hydroxyethyl)-4-methyl-5-[[5-(3-nitro-4-piperidin-1-ylphenyl)furan-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 50884861) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is (5E)-1-(2-hydroxyethyl)-4-methyl-5-[[5-(3-nitro-4-piperidin-1-ylphenyl)furan-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-1-(2-hydroxyethyl)-4-methyl-5-[[5-(3-nitro-4-piperidin-1-ylphenyl)furan-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 50884861 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (5E)-1-(2-hydroxyethyl)-4-methyl-5-[[5-(3-nitro-4-piperidin-1-ylphenyl)furan-2-yl]methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(CCO)C(=O)/C1=C/c1ccc(-c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C25H24N4O6/c1-16-19(24(31)28(11-12-30)25(32)20(16)15-26)14-18-6-8-23(35-18)17-5-7-21(22(13-17)29(33)34)27-9-3-2-4-10-27/h5-8,13-14,30H,2-4,9-12H2,1H3/b19-14+ |
| InChIKey | DLAFGENAUNFGDY-XMHGGMMESA-N |
| XLogP | 3.43 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|