C26H27N3O2 — CID 50887248
5-[(3-tert-butyl-5-methyl-2-phenylmethoxyphenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 50887248) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 5-[(3-tert-butyl-5-methyl-2-phenylmethoxyphenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(3-tert-butyl-5-methyl-2-phenylmethoxyphenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 50887248 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 5-[(3-tert-butyl-5-methyl-2-phenylmethoxyphenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1cc(/C=N/c2ccc3[nH]c(=O)[nH]c3c2)c(OCc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H27N3O2/c1-17-12-19(15-27-20-10-11-22-23(14-20)29-25(30)28-22)24(21(13-17)26(2,3)4)31-16-18-8-6-5-7-9-18/h5-15H,16H2,1-4H3,(H2,28,29,30)/b27-15+ |
| InChIKey | TVFCZPDEFHGOIM-JFLMPSFJSA-N |
| XLogP | 5.79 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|