C13H9NO5 — CID 50888363
7-[5-[(E)-hydroxyiminomethyl]furan-2-yl]-1,3-benzodioxin-4-one (PubChem CID 50888363) has the molecular formula C13H9NO5 and a molecular weight of 259.22 g/mol. Its IUPAC name is 7-[5-[(E)-hydroxyiminomethyl]furan-2-yl]-1,3-benzodioxin-4-one.
| Compound Name | 7-[5-[(E)-hydroxyiminomethyl]furan-2-yl]-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 50888363 |
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 7-[5-[(E)-hydroxyiminomethyl]furan-2-yl]-1,3-benzodioxin-4-one |
| SMILES | O=C1OCOc2cc(-c3ccc(/C=N/O)o3)ccc21 |
| InChI | InChI=1S/C13H9NO5/c15-13-10-3-1-8(5-12(10)17-7-18-13)11-4-2-9(19-11)6-14-16/h1-6,16H,7H2/b14-6+ |
| InChIKey | KECVAFVZHORMRB-MKMNVTDBSA-N |
| XLogP | 2.26 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|