C24H19NO8 — CID 50888386
2,2-dimethyl-5-[[5-(5-nitro-2-phenylmethoxyphenyl)furan-2-yl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 50888386) has the molecular formula C24H19NO8 and a molecular weight of 449.42 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[5-(5-nitro-2-phenylmethoxyphenyl)furan-2-yl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[5-(5-nitro-2-phenylmethoxyphenyl)furan-2-yl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 50888386 |
| Molecular Formula | C24H19NO8 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 2,2-dimethyl-5-[[5-(5-nitro-2-phenylmethoxyphenyl)furan-2-yl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2ccc(-c3cc([N+](=O)[O-])ccc3OCc3ccccc3)o2)C(=O)O1 |
| InChI | InChI=1S/C24H19NO8/c1-24(2)32-22(26)19(23(27)33-24)13-17-9-11-21(31-17)18-12-16(25(28)29)8-10-20(18)30-14-15-6-4-3-5-7-15/h3-13H,14H2,1-2H3 |
| InChIKey | MONJSDGKCLZQHI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 118.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|