C22H22N2O7 — CID 50888481
2,2-dimethyl-5-[[5-(5-nitro-2-piperidin-1-ylphenyl)furan-2-yl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 50888481) has the molecular formula C22H22N2O7 and a molecular weight of 426.43 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[5-(5-nitro-2-piperidin-1-ylphenyl)furan-2-yl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[5-(5-nitro-2-piperidin-1-ylphenyl)furan-2-yl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 50888481 |
| Molecular Formula | C22H22N2O7 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2,2-dimethyl-5-[[5-(5-nitro-2-piperidin-1-ylphenyl)furan-2-yl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2ccc(-c3cc([N+](=O)[O-])ccc3N3CCCCC3)o2)C(=O)O1 |
| InChI | InChI=1S/C22H22N2O7/c1-22(2)30-20(25)17(21(26)31-22)13-15-7-9-19(29-15)16-12-14(24(27)28)6-8-18(16)23-10-4-3-5-11-23/h6-9,12-13H,3-5,10-11H2,1-2H3 |
| InChIKey | BRDAXAAYJYLNEY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|