C16H13BrCl2N2O4S — CID 50889349
2-(N-(4-acetamidophenyl)sulfonyl-4-bromo-2-chloroanilino)acetyl chloride (PubChem CID 50889349) has the molecular formula C16H13BrCl2N2O4S and a molecular weight of 480.17 g/mol. Its IUPAC name is 2-(N-(4-acetamidophenyl)sulfonyl-4-bromo-2-chloroanilino)acetyl chloride.
| Compound Name | 2-(N-(4-acetamidophenyl)sulfonyl-4-bromo-2-chloroanilino)acetyl chloride |
|---|---|
| PubChem CID | 50889349 |
| Molecular Formula | C16H13BrCl2N2O4S |
| Molecular Weight | 480.17 g/mol |
| Exact Mass | 477.92 |
| IUPAC Name | 2-(N-(4-acetamidophenyl)sulfonyl-4-bromo-2-chloroanilino)acetyl chloride |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CC(=O)Cl)c2ccc(Br)cc2Cl)cc1 |
| InChI | InChI=1S/C16H13BrCl2N2O4S/c1-10(22)20-12-3-5-13(6-4-12)26(24,25)21(9-16(19)23)15-7-2-11(17)8-14(15)18/h2-8H,9H2,1H3,(H,20,22) |
| InChIKey | TZLBNDOAEZHYTN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|