C25H27NO3 — CID 50906405
(1S,5S,6R,7S)-3-[(1R)-1-naphthalen-1-ylethyl]-6-phenylmethoxy-8-oxa-3-azabicyclo[5.1.0]octan-5-ol (PubChem CID 50906405) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (1S,5S,6R,7S)-3-[(1R)-1-naphthalen-1-ylethyl]-6-phenylmethoxy-8-oxa-3-azabicyclo[5.1.0]octan-5-ol.
| Compound Name | (1S,5S,6R,7S)-3-[(1R)-1-naphthalen-1-ylethyl]-6-phenylmethoxy-8-oxa-3-azabicyclo[5.1.0]octan-5-ol |
|---|---|
| PubChem CID | 50906405 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (1S,5S,6R,7S)-3-[(1R)-1-naphthalen-1-ylethyl]-6-phenylmethoxy-8-oxa-3-azabicyclo[5.1.0]octan-5-ol |
| SMILES | C[C@H](c1cccc2ccccc12)N1C[C@@H]2O[C@@H]2[C@H](OCc2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C25H27NO3/c1-17(20-13-7-11-19-10-5-6-12-21(19)20)26-14-22(27)24(25-23(15-26)29-25)28-16-18-8-3-2-4-9-18/h2-13,17,22-25,27H,14-16H2,1H3/t17-,22+,23+,24-,25+/m1/s1 |
| InChIKey | GJCDEQZMRISDIA-YLGITICZSA-N |
| XLogP | 3.93 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|