C19H21NO4S — CID 50906433
4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidine-2-thione (PubChem CID 50906433) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidine-2-thione.
| Compound Name | 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidine-2-thione |
|---|---|
| PubChem CID | 50906433 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-(3,4,5-trimethoxyphenyl)azetidine-2-thione |
| SMILES | COc1ccc(C2CC(=S)N2c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-21-14-7-5-12(6-8-14)15-11-18(25)20(15)13-9-16(22-2)19(24-4)17(10-13)23-3/h5-10,15H,11H2,1-4H3 |
| InChIKey | KDPLWIVBPCAVCP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|