About cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide)
cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide) (PubChem CID 50910504) has the molecular formula C34H34CoN4O4
and a molecular weight of 621.60 g/mol. Its IUPAC name is cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide).
Molecular Properties
| Compound Name | cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide) |
| PubChem CID | 50910504 |
| Molecular Formula | C34H34CoN4O4 |
| Molecular Weight | 621.60 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide) |
| SMILES | COc1ccc(/N=C/C=C[N-]c2ccc(OC)cc2)cc1.COc1ccc(/N=C/C=C[N-]c2ccc(OC)cc2)cc1.[Co+2] |
| InChI | InChI=1S/2C17H17N2O2.Co/c2*1-20-16-8-4-14(5-9-16)18-12-3-13-19-15-6-10-17(21-2)11-7-15;/h2*3-13H,1-2H3;/q2*-1;+2/b2*12-3?,19-13+; |
| InChIKey | YBOOVFLIPSMVQH-SUQQYQJISA-N |
| XLogP | 9.25 |
| TPSA | 89.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 621.60 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide)?
The IUPAC name of cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide) (CID 50910504) is cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide).
What is the SMILES notation for cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide)?
The canonical SMILES for cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide) is COc1ccc(/N=C/C=C[N-]c2ccc(OC)cc2)cc1.COc1ccc(/N=C/C=C[N-]c2ccc(OC)cc2)cc1.[Co+2].
What is the InChIKey of cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide)?
The InChIKey is YBOOVFLIPSMVQH-SUQQYQJISA-N. The full InChI is InChI=1S/2C17H17N2O2.Co/c2*1-20-16-8-4-14(5-9-16)18-12-3-13-19-15-6-10-17(21-2)11-7-15;/h2*3-13H,1-2H3;/q2*-1;+2/b2*12-3?,19-13+;.
What are the key properties of cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide)?
cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide) has a molecular weight of 621.60 g/mol, XLogP of 9.25, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis((4-methoxyphenyl)-[3-(4-methoxyphenyl)iminoprop-1-enyl]azanide) is sourced from PubChem (CID 50910504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).