C23H25N3O3 — CID 50911066
(2R,6R)-2-[2-(4-benzyltriazol-1-yl)ethyl]-6-(4-methoxyphenyl)oxan-4-one (PubChem CID 50911066) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2R,6R)-2-[2-(4-benzyltriazol-1-yl)ethyl]-6-(4-methoxyphenyl)oxan-4-one.
| Compound Name | (2R,6R)-2-[2-(4-benzyltriazol-1-yl)ethyl]-6-(4-methoxyphenyl)oxan-4-one |
|---|---|
| PubChem CID | 50911066 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (2R,6R)-2-[2-(4-benzyltriazol-1-yl)ethyl]-6-(4-methoxyphenyl)oxan-4-one |
| SMILES | COc1ccc([C@H]2CC(=O)C[C@@H](CCn3cc(Cc4ccccc4)nn3)O2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-28-21-9-7-18(8-10-21)23-15-20(27)14-22(29-23)11-12-26-16-19(24-25-26)13-17-5-3-2-4-6-17/h2-10,16,22-23H,11-15H2,1H3/t22-,23-/m1/s1 |
| InChIKey | FHXXNDVALWFPBB-DHIUTWEWSA-N |
| XLogP | 3.76 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |